| CAS No | Product Name | Molecular Formula |
|---|---|---|
| 68155-78-2 | Diethylenetriamine penta(methylene phosphonic acid) heptasaodium salt | C9H21N3Na7O15P5 |
| 68156-13-8 | Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate | C24H19S2.PF6 |
| 68157-60-8 | Forchlorfenuron | C12H10ClN3O |
| 68157-98-2 | 2-Isocyano-N,N-dimethylacetamide | C5H8N2O |
| 68160-76-9 | Nortetraphyllicine | C19H22N2O |
| 68162-47-0 | 4-(Bromomethyl)phenylboronic acid | C7H8BBrO2 |
| 68165-06-0 | 1-Methylpyrrolidin-3-one | C5H9NO |
| 68168-23-0 | beta-Cyclodextrin hydrate | C42H70O35.xH2O |
| 68169-03-9 / 68586-19-6 | (Dicyclopentadienyloxy)ethyl methacrylate | C16H22O3 |
| 68171-52-8 | N-Linoleoylethanolamine | C20H37NO2 |
| 68173-05-7 | N,N-Dimethyl-1,2-cyclohexanediamine | C8H18N2 |
| 68175-07-5 | 2-Methylimidazo[4,5-b]pyridine | C7H7N3 |
| 68176-57-8 | 4-(tert-Butyl)benzene-1,2-diamine | C10H16N2 |
| 68181-17-9 | 3-(2-Pyridyldithio)propionic acid N-hydroxysuccinimide ester | C12H12N2O4S2 |
| 68183-87-9 | Bis(cyclopentadienyl)hafnium dihydride | C10H12Hf |
| 68186-14-1 / 8050-12-2 | Resin acids, Me esters | |
| 68186-85-6 | C.I. Pigment Green 50 | |
| 68186-88-9 | C.I. Pigment Brown 33 | |
| 68186-90-3 | C.I. Pigment Brown 24 | |
| 68186-91-4 | C.I. Pigment Black 28 | |
| 68186-94-7 | C.I. Pigment Black 26 | Fe3Mn3O8 |
| 68186-97-0 | Pigment Black 27 | |
| 68187-11-1 | Pigment Blue 36 | |
| 68187-32-6 | Disodium 2-aminopentanedioate | C5H7NNa2O4 |
| 68187-51-9 | C.I. Pigment Yellow 119 | |
| 68187-53-1 | C.I. Pigment Red 236 | |
| 68187-76-8 | Castor oil, sulfated, sodium salt | |
| 68188-12-5 | Perfluoro-C2-18-alkylethyl iodides | C4H4F5I.(C2F4)n |
| 68188-27-2 | Tall oil fatty acid pentaerythritol esters | |
| 68188-85-2 | Rare earth fluorides | |
| 68188-88-5 | Rare earth chlorides | |
| 68189-01-5 | 2,2',2''-Nitrilotris[ethanol] 2-ethylhexyl phosphate (salt) | C8H18O.x(C6H15NO3).x(H3PO4) |
| 68189-23-1 | 4-(Diethylamino)benzaldehyde-1,1-diphenylhydrazone | C23H25N3 |
| 68189-43-5 | Piperazine-1,4-bis(2-hydroxypropanesulfonic acid) dihydrate | C10H22N2O8S2.2(H2O) |
| 68191-07-1 | 2,3-Dinitro-4-methylphenol | C7H6N2O5 |
| 68193-45-3 | Bis[(1,2,3,4,5-eta)-1-(1,1-dimethylethyl)-2,4-cyclopentadien-1-yl]dimethylhafnium | C20H32Hf |
| 68195-63-1 | 5,5',5''-Trimethyl-2,2',2''-triphenyl-[4,4':4',4''-ter-4H-pyrazole]-3,3',3''(2H,2'H,2''H)-trione | C30H26N6O3 |
| 68200-68-0 | 5'-Deoxy-5'-iodoguanosine | C10H12IN5O4 |
| 68201-32-1 | Sodium asphalt sulfonate | |
| 68201-39-8 | Fatty acids, dehydrated castor-oil, esters with pentaerythritol | |
| 68201-93-4 | Formaldehyde, polymer with 2,5-diethoxy-4-[(4-methylphenyl)thio]benzenediazonium sulfate | |
| 68206-04-2 | 3-Chloro-4-methylpyridazine | C5H5ClN2 |
| 68206-10-0 | 3,4-Dimethylpyridazine | C6H8N2 |
| 68206-94-0 | Cloricromene | C20H26ClNO5 |
| 68207-00-1 | Dodecylethyldimethylammonium bromide | C16H36BrN |
| 68208-18-4 | 3-Amino-3-(4-methylphenyl)propionic acid | C10H13NO2 |
| 68208-19-5 | 3-Amino-3-(3-methoxyphenyl)propionic acid | C10H13NO3 |
| 68208-20-8 | 3-Amino-3-(2-chlorophenyl)propionic acid | C9H10ClNO2 |
| 68208-21-9 | 3-Amino-3-(3'-chlorophenyl)propanoic acid | C9H10ClNO2 |
| 68208-22-0 | 3-Amino-3-(3-methylphenyl)propan-1-ol | C10H15NO |