Online Database of Chemicals from Around the World
| CAS No | Product Name | Molecular Formula |
|---|---|---|
| 68119-31-3 | 2-(2,2-Difluorobenzo[d][1,3]dioxol-5-yl)acetonitrile | C9H5F2NO2 |
| 68120-41-2 | 1-Bromo-1-[3-(trifluoromethyl)phenyl]ethane | C9H8BrF3 |
| 68120-44-5 | 4-Bromo-3-chlorobenzyl bromide | C7H5Br2Cl |
| 68121-36-8 | 2,4,4,4-Tetrachlorobutyryl chloride | C4H3Cl5O |
| 68121-46-0 | 3,5-Dichlorothioanisole | C7H6Cl2S |
| 68122-86-1 | Quaternium 27 | |
| 68123-16-0 | 1,3-Butadiene, telomer with bromotrichloromethane, ethenylbenzene and 2-methyl-2-propenoic acid | |
| 68123-30-8 | 2,3-Dihydroxanthotoxol | C11H8O4 |
| 68124-04-9 | Chonglou Saponin VII | C51H82O21 |
| 68124-64-1 | Tetrabutylammonium phthalate | 2(C16H36N).C8H4O4 |
| 68127-19-5 | Spirostan | C39H62O13 |
| 68127-22-0 | (-)-Menthyl (+)-2-pyrrolidone-5-carboxylate | C15H25NO3 |
| 68128-53-0 | Amylostatin XG | C19H33NO13 |
| 68128-59-6 | 4-(Octadecylamino)-4-oxosulfobutanoic acid diammonium salt | C22H43NO6S.2(NH3) |
| 68130-14-3 | Acetylated distarch phosphate | C2H4O2.x(H3PO4).x(C6H10O5) |
| 68130-20-1 | Starch phthalate | |
| 68130-47-2 | C8-10-Alkyl Alcohols ethoxylated phosphates | |
| 68130-55-2 | Hexanedioic acid, mixed esters with decanoic acid, heptanoic acid, octanoic acid and pentaerythritol | |
| 68130-60-9 | 2-Methyl-2-propenoic acid polymer with ethenylbenzene ethyl 2-propenoate and N-(hydroxymethyl)-2-propenamide butylated | |
| 68130-75-6 | Phosphoric acid, C14-18 and C16-18-unsatd. alkyl esters, sodium salts | |
| 68131-04-4 | Humic acid sodium salt | |
| 68131-32-8 | Fermented spent sulfite liquor | |
| 68131-37-3 | Hydrolyzed starch syrups, dehydrated | |
| 68131-73-7 | Polyethylene-polyamines | |
| 68131-77-1 | Petroleum resins | |
| 68132-21-8 | Perilla Oil | |
| 68132-83-2 | alpha(or beta)-Methyl-1H-imidazole-1-ethanol | C6H10N2O |
| 68133-69-7 | Disperse Red 177 | C20H18N6O4S |
| 68133-79-9 | 2-(3,7-Dimethyl-2,6-octadien-1-yl)cyclopentanone | C15H24O |
| 68133-87-9 | Potassium pentakis(cyano)aurate | K4Au(CN)5 |
| 68134-22-5 / 63661-02-9 | Pigment Yellow 154 | C18H14F3N5O3 |
| 68134-38-3 / 39279-59-9 | Basic Yellow 29 | C20H24N3.Cl |
| 68134-79-2 | 1,8-Dihydroxy-2,9-dithiatricyclo[8.4.0.03,8]tetradecane | C12H20O2S2 |
| 68139-52-6 | Fatty acids, tall-oil, polymers with isophthalic acid, trimellitic anhydride and trimethylolethane | |
| 68140-00-1 | Coconut oil monoethanolamide | C14H29NO2 |
| 68140-01-2 | N-[3-(dimethylamino)propyl] coco amides | |
| 68140-48-7 | Traseolide | C18H26O |
| 68140-82-9 | 2-Dodecanethiol, telomer with 1,3-butadiene and 2-propenenitrile | |
| 68141-12-8 | 3-(4-Methoxyphenyl)-2-propenoic acid propyl ester | C13H16O3 |
| 68144-21-8 | Jujuboside B1 | C52H84O21 |
| 68146-65-6 | Sodium tetrakis(1-imidazolyl)borate | C12H12BN8Na |
| 68152-92-1 | Disproportionated tall oil | |
| 68153-23-1 | Peanut oil, glycerol trioleate-enriched, sulfated, sodium salt | |
| 68153-38-8 | Perilla oil | |
| 68153-58-2 | Fatty acids, tall-oil, reaction products with diethanolamine and dodecylbenzenesulfonic acid | |
| 68154-97-2 | Alcohols, C10-12, ethoxylated propoxylated | C12H26O |
| 68154-99-4 | C8-C10 Alcohols ethers with polyethylene-polypropylene glycol monobenzyl ether | |
| 68155-09-9 | Cocamidopropylamine Oxide | |
| 68155-14-6 | Amides, from 2-[(2-aminoethyl)amino]ethanol and hydrogenated tallow | |
| 68155-69-1 | 2-Bromo-5-ethoxytoluene | C9H11BrO |