Online Database of Chemicals from Around the World
| CAS No | Product Name | Molecular Formula |
|---|---|---|
| 93957-42-7 | 3-(4-Fluorophenyl)-1-methyl-1H-indole-2-carbaldehyde | C16H12FNO |
| 93957-49-4 | 3-(4-Fluorophenyl)-1-isopropyl-1H-indole | C17H16FN |
| 93957-50-7 | (E)-3-[3'-(4''-Fluorophenyl)-1'-(1''-methylethyl)-1H-indol-2''-yl]-2-propnal | C20H18FNO |
| 93957-52-9 | 3-Methyl(E)-7-[3-(4-fluorophenyl)-1-methylethyl-indol-2-yl]-3-hydroxy-5-oxohept-6-enoate | C25H26FNO4 |
| 93957-53-0 | Fluvastatin methyl ester | C25H28FNO4 |
| 93957-54-1 | Fluvastatin | C24H26FNO4 |
| 93957-55-2 | Fluvastatin sodium salt | C24H25FNNaO4 |
| 93957-58-5 | Fluvastatin EP Impurity A Sodium Salt | C24H25FNNaO4 |
| 93960-20-4 | L-3-Pyridylalanine hydrochloride | C8H10N2O2.HCl |
| 93960-21-5 | (R)-2-Amino-3-(pyridin-3-yl)propanoic acid dihydrochloride | C8H12Cl2N2O2 |
| 93962-51-7 | 3-(4-Chloro-2-methylphenyl)-1-triazene-1-carbonitrile sodium salt | C8H7ClN4.Na |
| 93962-80-2 | 1-Aziridinepropanoic acid (octahydro-4,7-methano-1H-indene-5,?-diyl)bis(methylene) ester | C22H34N2O4 |
| 93962-81-3 | Octahydro-N,N'-dimethyl-4,7-methano-1H-indene-5,?-dimethanamine | C14H26N2 |
| 93963-02-1 | N-[4-[[4-(Diethylamino)phenyl](2,4-disulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl-ethanaminium inner salt ammonium salt | C27H32N2O6S2.NH3 |
| 93963-24-7 | Ethyl[1-(4-methoxyphenyl)propan-2-yl]amine hydrochloride | C12H19NO.HCl |
| 93963-31-6 | 2-Phenylbicyclo[2.2.1]heptane-2-carboxylic acid | C14H16O2 |
| 93964-77-3 | L-Arginine L-malate | C6H14N4O2.C4H6O5 |
| 93965-03-8 | 5-[[4,6-bis[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]-2-[2-[4-[[4-[Bis(2-hydroxyethyl)amino]-6-[(4-sulfophenyl)amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid sodium salt compd. with 2,2'-iminobis[ethanol] | C38H48N12O15S3.x(C4H11NO2).x(Na) |
| 93966-36-0 | [R-(Z)]-(12-Hydroxy-9-octadecenoato-O1)oxo-aluminum | C18H33AlO4 |
| 93966-41-7 | 1-Methyl-N-phenyl-N-(phenylmethyl)-4-piperidinamine compd. with 5-oxo-L-proline (1:2) | C19H24N2.2(C5H7NO3) |
| 93966-65-5 | 5'-O-[Bis(4-methoxyphenyl)phenylmethyl]-2'-deoxy-N-(2-methyl-1-oxopropyl)-Guanosine 3'-benzoate | C42H41N5O8 |
| 93967-75-0 | Methyl (2S,4S)-N-Boc-4-phenoxy-2-pyrrolidinecarboxylate | C17H23NO5 |
| 93972-01-1 | 4-Nonylbiphenyl | C21H28 |
| 93972-05-5 | 4'-Propylbiphenyl-4-carboxaldehyde | C16H16O |
| 93979-06-7 | 4-Nitrophenyl 3-O-alpha-D-mannopyranosyl-alpha-D-mannopyranoside | C18H25NO13 |
| 93979-14-7 | Methyl (E)-4-decenoate | C11H20O2 |
| 93980-55-3 | Cytidine 5'-(trihydrogen diphosphate), compd. with 2-aminoethanol (1:1), monosodium salt | C9H15N3O11P2.C2H7NO.Na |
| 93980-66-6 | (9Z,12R)-12-Hydroxy-9-octadecenoic acid octyl ester | C26H50O3 |
| 93980-86-0 | 3-(1,3-Dimethylbutyl)cyclopentene tetradehydro deriv. | C11H16 |
| 93980-88-2 | D&C Orange 5 zirconium lake | C20H10Br2O5.x(Zr) |
| 93981-05-6 | Tetrasodium [5-[[6-[[4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-3-sulfophenyl]amino]-1-hydroxy-3-sulfo-2-naphthalenyl]azo]-4-hydroxy-1,3-benzenedisulfonato]cuprate | C25H13ClCuN8O14S4.Na4 |
| 93981-14-7 | 2,2',2''-Nitrilotrisethanol 6-[[(4-methylphenyl)sulfonyl]amino]hexanoate (salt) | C13H19NO4S.C6H15NO3 |
| 93981-19-2 | D-Gluconic acid, 6-ester with N,N-bis(1-methylethyl)glycine, calcium salt (2:1) | 2(C14H27NO8).Ca |
| 93981-29-4 | (17R,21alpha)-Ajmalan-17,21-diol compd. with 1-bromopropane (1:1) | C20H26N2O2.C3H7Br |
| 93981-66-9 | (OC-6-31)-Bis(dibutylcarbamodithioato-S,S')(morpholine-N4,O1)zinc | C22H45N3OS4Zn |
| 93981-71-6 | 5,5'-[(1-Methylethylidene)bis(4,1-phenyleneoxysulfonyl-2,1-phenyleneazo)]bis[6-amino-4-hydroxy-2-naphthalenesulfonic acid] sodium salt | C47H38N6O14S4.x(Na) |
| 93981-92-1 | N-Hexadecyl-N,N-dimethyl-benzenemethanaminium salt with 4-octylphenol | C25H46N.C14H21O |
| 93982-47-9 | Methyl 4-(1,1,2,2-tetrafluoroethoxy)benzoate | C10H8F4O3 |
| 93982-54-8 | 5,5'-[Carbonylbis(imino-4,1-phenyleneazo)]bis[8-[(4-sulfophenyl)azo]-2-naphthalenesulfonic acid sodium salt | C45H32N10O13S4.x(Na) |
| 93982-72-0 | 9,10-Dihydro-3,4-dihydroxy-9,10-dioxo-2-anthracenesulfonic acid disodium salt | C14H6O7S.2Na |
| 93982-95-7 | Chloroacetic acid compd. with cyclohexanamine (1:1) | C6H13N.C2H3ClO2 |
| 93982-96-8 | N,N'-Diphenylguanidine monohydrobromide | C13H13N3.HBr |
| 93983-12-1 | [1,2-Ethanediylbis[nitrilobis(methylene)]]tetrakisphosphonic acid heptaammonium salt | C6H20N2O12P4.7(NH3) |
| 93983-72-3 | Dimethylphenol hydrogen phosphorodithioate zinc salt | C32H36O4P2S4Zn |
| 93985-45-6 | 3-Iodobenzeneethanamine | C8H10IN |
| 93989-32-3 | 2-Bromo-1-phenylnaphthalene | C16H11Br |
| 94001-64-6 | 3-Methoxy-alpha-methyl-alpha-phenylbenzenemethanol | C15H16O2 |
| 94001-65-7 | 4-Methoxy-alpha-methyl-alpha-phenylbenzenemethanol | C15H16O2 |
| 94006-32-3 | Boric acid (H3BO3), compd. with 1,1',1''-nitrilotris[2-propanol] | C9H21NO3.x(H3BO3) |
| 94010-78-3 | alpha,alpha,4-Trifluorobenzeneacetic acid | C8H5F3O2 |